C21H37N3O6 — CID 22096255
methyl 1-[2-[2-[[formyl(hydroxy)amino]methyl]hexanoylamino]-3,3-dimethylbutanoyl]piperidine-4-carboxylate (PubChem CID 22096255) has the molecular formula C21H37N3O6 and a molecular weight of 427.54 g/mol. Its IUPAC name is methyl 1-[2-[2-[[formyl(hydroxy)amino]methyl]hexanoylamino]-3,3-dimethylbutanoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[2-[[formyl(hydroxy)amino]methyl]hexanoylamino]-3,3-dimethylbutanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 22096255 |
| Molecular Formula | C21H37N3O6 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | methyl 1-[2-[2-[[formyl(hydroxy)amino]methyl]hexanoylamino]-3,3-dimethylbutanoyl]piperidine-4-carboxylate |
| SMILES | CCCCC(CN(O)C=O)C(=O)NC(C(=O)N1CCC(C(=O)OC)CC1)C(C)(C)C |
| InChI | InChI=1S/C21H37N3O6/c1-6-7-8-16(13-24(29)14-25)18(26)22-17(21(2,3)4)19(27)23-11-9-15(10-12-23)20(28)30-5/h14-17,29H,6-13H2,1-5H3,(H,22,26) |
| InChIKey | GSESDKWFFRDTCU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|