C19H38N4O4 — CID 158875091
(2S)-2-[[2-[[formyl(hydroxy)amino]methyl]-3-piperidin-1-ylpropanoyl]amino]-N,N,3,3-tetramethylbutanamide;methane (PubChem CID 158875091) has the molecular formula C19H38N4O4 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2S)-2-[[2-[[formyl(hydroxy)amino]methyl]-3-piperidin-1-ylpropanoyl]amino]-N,N,3,3-tetramethylbutanamide;methane.
| Compound Name | (2S)-2-[[2-[[formyl(hydroxy)amino]methyl]-3-piperidin-1-ylpropanoyl]amino]-N,N,3,3-tetramethylbutanamide;methane |
|---|---|
| PubChem CID | 158875091 |
| Molecular Formula | C19H38N4O4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (2S)-2-[[2-[[formyl(hydroxy)amino]methyl]-3-piperidin-1-ylpropanoyl]amino]-N,N,3,3-tetramethylbutanamide;methane |
| SMILES | C.CN(C)C(=O)[C@@H](NC(=O)C(CN(O)C=O)CN1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C18H34N4O4.CH4/c1-18(2,3)15(17(25)20(4)5)19-16(24)14(12-22(26)13-23)11-21-9-7-6-8-10-21;/h13-15,26H,6-12H2,1-5H3,(H,19,24);1H4/t14?,15-;/m1./s1 |
| InChIKey | JCIIVINGIQQZAZ-NUNOUFIPSA-N |
| XLogP | 1.19 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|