C16H28N6O3 — CID 87264719
N-[(2R)-2-[[[4-(aminomethyl)-5,6-dimethylpyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87264719) has the molecular formula C16H28N6O3 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[(2R)-2-[[[4-(aminomethyl)-5,6-dimethylpyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[[4-(aminomethyl)-5,6-dimethylpyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264719 |
| Molecular Formula | C16H28N6O3 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-[(2R)-2-[[[4-(aminomethyl)-5,6-dimethylpyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNc1nc(C)c(C)c(CN)n1 |
| InChI | InChI=1S/C16H28N6O3/c1-4-5-6-7-13(9-22(25)10-23)15(24)20-21-16-18-12(3)11(2)14(8-17)19-16/h10,13,25H,4-9,17H2,1-3H3,(H,20,24)(H,18,19,21) |
| InChIKey | GJBMADNYOBNOMV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|