C18H29FN6O4 — CID 87263887
N-[(2R)-2-[[(5-fluoro-4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87263887) has the molecular formula C18H29FN6O4 and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[(2R)-2-[[(5-fluoro-4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[(5-fluoro-4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87263887 |
| Molecular Formula | C18H29FN6O4 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-[(2R)-2-[[(5-fluoro-4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1nc(C)c(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H29FN6O4/c1-3-4-5-6-14(11-25(28)12-26)17(27)22-23-18-20-13(2)15(19)16(21-18)24-7-9-29-10-8-24/h12,14,28H,3-11H2,1-2H3,(H,22,27)(H,20,21,23)/t14-/m1/s1 |
| InChIKey | OXTATROBJZTHDT-CQSZACIVSA-N |
| XLogP | 1.25 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|