C18H31N7O3 — CID 87264654
N-[(2R)-2-[[[4-cyclopropyl-6-[ethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87264654) has the molecular formula C18H31N7O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(2R)-2-[[[4-cyclopropyl-6-[ethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[[4-cyclopropyl-6-[ethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264654 |
| Molecular Formula | C18H31N7O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-[(2R)-2-[[[4-cyclopropyl-6-[ethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1nc(C2CC2)nc(N(C)CC)n1 |
| InChI | InChI=1S/C18H31N7O3/c1-4-6-7-8-14(11-25(28)12-26)16(27)22-23-17-19-15(13-9-10-13)20-18(21-17)24(3)5-2/h12-14,28H,4-11H2,1-3H3,(H,22,27)(H,19,20,21,23)/t14-/m1/s1 |
| InChIKey | VDTRUZOFTIFLPK-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|