C19H32N6O3 — CID 87264176
N-[(2R)-2-[[(4,5-dimethyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87264176) has the molecular formula C19H32N6O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[(2R)-2-[[(4,5-dimethyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[(4,5-dimethyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264176 |
| Molecular Formula | C19H32N6O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-[(2R)-2-[[(4,5-dimethyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1nc(C)c(C)c(N2CCCC2)n1 |
| InChI | InChI=1S/C19H32N6O3/c1-4-5-6-9-16(12-25(28)13-26)18(27)22-23-19-20-15(3)14(2)17(21-19)24-10-7-8-11-24/h13,16,28H,4-12H2,1-3H3,(H,22,27)(H,20,21,23)/t16-/m1/s1 |
| InChIKey | CWKGKPYPJKQIQW-MRXNPFEDSA-N |
| XLogP | 2.18 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|