C23H40N8O3 — CID 87264355
N-[2-[[[4-[(1R)-1-[cyclopropyl-(1-methylpiperidin-4-yl)amino]ethyl]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87264355) has the molecular formula C23H40N8O3 and a molecular weight of 476.63 g/mol. Its IUPAC name is N-[2-[[[4-[(1R)-1-[cyclopropyl-(1-methylpiperidin-4-yl)amino]ethyl]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[2-[[[4-[(1R)-1-[cyclopropyl-(1-methylpiperidin-4-yl)amino]ethyl]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264355 |
| Molecular Formula | C23H40N8O3 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N-[2-[[[4-[(1R)-1-[cyclopropyl-(1-methylpiperidin-4-yl)amino]ethyl]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNc1ncnc([C@@H](C)N(C2CC2)C2CCN(C)CC2)n1 |
| InChI | InChI=1S/C23H40N8O3/c1-4-5-6-7-18(14-30(34)16-32)22(33)27-28-23-25-15-24-21(26-23)17(2)31(19-8-9-19)20-10-12-29(3)13-11-20/h15-20,34H,4-14H2,1-3H3,(H,27,33)(H,24,25,26,28)/t17-,18?/m1/s1 |
| InChIKey | BRRKVUCZAYNAKU-QNSVNVJESA-N |
| XLogP | 1.98 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|