C18H33N7O3 — CID 143005417
N-[2-[[[4-(dimethylamino)-6-heptyl-1,3,5-triazin-2-yl]amino]carbamoyl]butyl]-N-hydroxyformamide (PubChem CID 143005417) has the molecular formula C18H33N7O3 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[2-[[[4-(dimethylamino)-6-heptyl-1,3,5-triazin-2-yl]amino]carbamoyl]butyl]-N-hydroxyformamide.
| Compound Name | N-[2-[[[4-(dimethylamino)-6-heptyl-1,3,5-triazin-2-yl]amino]carbamoyl]butyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 143005417 |
| Molecular Formula | C18H33N7O3 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[2-[[[4-(dimethylamino)-6-heptyl-1,3,5-triazin-2-yl]amino]carbamoyl]butyl]-N-hydroxyformamide |
| SMILES | CCCCCCCc1nc(NNC(=O)C(CC)CN(O)C=O)nc(N(C)C)n1 |
| InChI | InChI=1S/C18H33N7O3/c1-5-7-8-9-10-11-15-19-17(21-18(20-15)24(3)4)23-22-16(27)14(6-2)12-25(28)13-26/h13-14,28H,5-12H2,1-4H3,(H,22,27)(H,19,20,21,23) |
| InChIKey | KNSBSCMHECVYPS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|