C26H37N7O3 — CID 86621283
N-[(2R)-2-[[[4-but-3-enyl-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]carbamoyl]oct-7-enyl]-N-phenylmethoxyformamide (PubChem CID 86621283) has the molecular formula C26H37N7O3 and a molecular weight of 495.63 g/mol. Its IUPAC name is N-[(2R)-2-[[[4-but-3-enyl-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]carbamoyl]oct-7-enyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2R)-2-[[[4-but-3-enyl-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]carbamoyl]oct-7-enyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 86621283 |
| Molecular Formula | C26H37N7O3 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | N-[(2R)-2-[[[4-but-3-enyl-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]carbamoyl]oct-7-enyl]-N-phenylmethoxyformamide |
| SMILES | C=CCCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)NNc1nc(CCC=C)nc(N(C)C)n1 |
| InChI | InChI=1S/C26H37N7O3/c1-5-7-9-13-16-22(18-33(20-34)36-19-21-14-11-10-12-15-21)24(35)30-31-25-27-23(17-8-6-2)28-26(29-25)32(3)4/h5-6,10-12,14-15,20,22H,1-2,7-9,13,16-19H2,3-4H3,(H,30,35)(H,27,28,29,31)/t22-/m1/s1 |
| InChIKey | UDOHYRJYPSNWKG-JOCHJYFZSA-N |
| XLogP | 3.45 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|