C35H38N2O7 — CID 167543833
2-benzyl-3-[formyl(phenylmethoxy)amino]propanoic acid;2-benzyl-4-phenylbutanoic acid;nitroxyl (PubChem CID 167543833) has the molecular formula C35H38N2O7 and a molecular weight of 598.70 g/mol. Its IUPAC name is 2-benzyl-3-[formyl(phenylmethoxy)amino]propanoic acid;2-benzyl-4-phenylbutanoic acid;nitroxyl.
| Compound Name | 2-benzyl-3-[formyl(phenylmethoxy)amino]propanoic acid;2-benzyl-4-phenylbutanoic acid;nitroxyl |
|---|---|
| PubChem CID | 167543833 |
| Molecular Formula | C35H38N2O7 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 2-benzyl-3-[formyl(phenylmethoxy)amino]propanoic acid;2-benzyl-4-phenylbutanoic acid;nitroxyl |
| SMILES | N=O.O=C(O)C(CCc1ccccc1)Cc1ccccc1.O=CN(CC(Cc1ccccc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO4.C17H18O2.HNO/c20-14-19(23-13-16-9-5-2-6-10-16)12-17(18(21)22)11-15-7-3-1-4-8-15;18-17(19)16(13-15-9-5-2-6-10-15)12-11-14-7-3-1-4-8-14;1-2/h1-10,14,17H,11-13H2,(H,21,22);1-10,16H,11-13H2,(H,18,19);1H |
| InChIKey | BNPPPKKJFAQJFR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|