C32H33N3O7S — CID 118225964
N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]-4-phenylbutanoyl]amino]methyl]-N-(3-methylsulfonylphenyl)furan-2-carboxamide (PubChem CID 118225964) has the molecular formula C32H33N3O7S and a molecular weight of 603.70 g/mol. Its IUPAC name is N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]-4-phenylbutanoyl]amino]methyl]-N-(3-methylsulfonylphenyl)furan-2-carboxamide.
| Compound Name | N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]-4-phenylbutanoyl]amino]methyl]-N-(3-methylsulfonylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 118225964 |
| Molecular Formula | C32H33N3O7S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]-4-phenylbutanoyl]amino]methyl]-N-(3-methylsulfonylphenyl)furan-2-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(N(CNC(=O)[C@H](CCc2ccccc2)CN(C=O)OCc2ccccc2)C(=O)c2ccco2)c1 |
| InChI | InChI=1S/C32H33N3O7S/c1-43(39,40)29-15-8-14-28(20-29)35(32(38)30-16-9-19-41-30)23-33-31(37)27(18-17-25-10-4-2-5-11-25)21-34(24-36)42-22-26-12-6-3-7-13-26/h2-16,19-20,24,27H,17-18,21-23H2,1H3,(H,33,37)/t27-/m1/s1 |
| InChIKey | OCEYCXQYSUBCCR-HHHXNRCGSA-N |
| XLogP | 4.24 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|