C18H32N7O3+ — CID 91523949
(R)-cyclopropyl-ethyl-[4-[2-[2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-1,3,5-triazin-2-yl]-methylazanium (PubChem CID 91523949) has the molecular formula C18H32N7O3+ and a molecular weight of 394.50 g/mol. Its IUPAC name is (R)-cyclopropyl-ethyl-[4-[2-[2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-1,3,5-triazin-2-yl]-methylazanium.
| Compound Name | (R)-cyclopropyl-ethyl-[4-[2-[2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-1,3,5-triazin-2-yl]-methylazanium |
|---|---|
| PubChem CID | 91523949 |
| Molecular Formula | C18H32N7O3+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (R)-cyclopropyl-ethyl-[4-[2-[2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-1,3,5-triazin-2-yl]-methylazanium |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNc1ncnc([N@+](C)(CC)C2CC2)n1 |
| InChI | InChI=1S/C18H31N7O3/c1-4-6-7-8-14(11-24(28)13-26)16(27)22-23-17-19-12-20-18(21-17)25(3,5-2)15-9-10-15/h12-15,28H,4-11H2,1-3H3,(H-,19,20,21,22,23,27)/p+1/t14?,25-/m1/s1 |
| InChIKey | PTIJPVKVZRHZCL-GCMQXMDSSA-O |
| XLogP | 1.48 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|