C19H30F3N7O3 — CID 135746588
N-hydroxy-N-[(2S)-2-[[[5-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide (PubChem CID 135746588) has the molecular formula C19H30F3N7O3 and a molecular weight of 461.49 g/mol. Its IUPAC name is N-hydroxy-N-[(2S)-2-[[[5-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[(2S)-2-[[[5-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 135746588 |
| Molecular Formula | C19H30F3N7O3 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | N-hydroxy-N-[(2S)-2-[[[5-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCC[C@@H](CN(O)C=O)C(=O)NNc1ncc(N2CCN(C)CC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H30F3N7O3/c1-3-4-5-6-14(12-29(32)13-30)17(31)25-26-18-23-11-15(16(24-18)19(20,21)22)28-9-7-27(2)8-10-28/h11,13-14,32H,3-10,12H2,1-2H3,(H,25,31)(H,23,24,26)/t14-/m0/s1 |
| InChIKey | YCRKHDOYHNCVGS-AWEZNQCLSA-N |
| XLogP | 1.73 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|