C15H22Cl2N4O3 — CID 87928774
1-(3,4-dichlorophenyl)-3-[2-[(hydroxyamino)methyl]heptanoylamino]urea (PubChem CID 87928774) has the molecular formula C15H22Cl2N4O3 and a molecular weight of 377.27 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-[(hydroxyamino)methyl]heptanoylamino]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-[(hydroxyamino)methyl]heptanoylamino]urea |
|---|---|
| PubChem CID | 87928774 |
| Molecular Formula | C15H22Cl2N4O3 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-[(hydroxyamino)methyl]heptanoylamino]urea |
| SMILES | CCCCCC(CNO)C(=O)NNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N4O3/c1-2-3-4-5-10(9-18-24)14(22)20-21-15(23)19-11-6-7-12(16)13(17)8-11/h6-8,10,18,24H,2-5,9H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | DOUAVCIFVKAUMA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|