C22H31N5O6 — CID 87264534
N-hydroxy-N-[2-[[[4-(2,3,4-trimethoxyphenyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide (PubChem CID 87264534) has the molecular formula C22H31N5O6 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-hydroxy-N-[2-[[[4-(2,3,4-trimethoxyphenyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[2-[[[4-(2,3,4-trimethoxyphenyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 87264534 |
| Molecular Formula | C22H31N5O6 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-hydroxy-N-[2-[[[4-(2,3,4-trimethoxyphenyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNc1nccc(-c2ccc(OC)c(OC)c2OC)n1 |
| InChI | InChI=1S/C22H31N5O6/c1-5-6-7-8-15(13-27(30)14-28)21(29)25-26-22-23-12-11-17(24-22)16-9-10-18(31-2)20(33-4)19(16)32-3/h9-12,14-15,30H,5-8,13H2,1-4H3,(H,25,29)(H,23,24,26) |
| InChIKey | PYGDVHDFBLCASS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|