C15H22F3N5O3 — CID 87264638
N-[5,5-dimethyl-2-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]hexyl]-N-hydroxyformamide (PubChem CID 87264638) has the molecular formula C15H22F3N5O3 and a molecular weight of 377.37 g/mol. Its IUPAC name is N-[5,5-dimethyl-2-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]hexyl]-N-hydroxyformamide.
| Compound Name | N-[5,5-dimethyl-2-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]hexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264638 |
| Molecular Formula | C15H22F3N5O3 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[5,5-dimethyl-2-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]hexyl]-N-hydroxyformamide |
| SMILES | CC(C)(C)CCC(CN(O)C=O)C(=O)NNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H22F3N5O3/c1-14(2,3)6-4-10(8-23(26)9-24)12(25)21-22-13-19-7-5-11(20-13)15(16,17)18/h5,7,9-10,26H,4,6,8H2,1-3H3,(H,21,25)(H,19,20,22) |
| InChIKey | KPMRDOQMUUONIV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|