C19H29F3N6O4 — CID 87264020
N-[4,4-dimethyl-2-[[[5-morpholin-4-yl-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]hexyl]-N-hydroxyformamide (PubChem CID 87264020) has the molecular formula C19H29F3N6O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is N-[4,4-dimethyl-2-[[[5-morpholin-4-yl-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]hexyl]-N-hydroxyformamide.
| Compound Name | N-[4,4-dimethyl-2-[[[5-morpholin-4-yl-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]hexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264020 |
| Molecular Formula | C19H29F3N6O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[4,4-dimethyl-2-[[[5-morpholin-4-yl-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]hexyl]-N-hydroxyformamide |
| SMILES | CCC(C)(C)CC(CN(O)C=O)C(=O)NNc1ncc(N2CCOCC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H29F3N6O4/c1-4-18(2,3)9-13(11-28(31)12-29)16(30)25-26-17-23-10-14(15(24-17)19(20,21)22)27-5-7-32-8-6-27/h10,12-13,31H,4-9,11H2,1-3H3,(H,25,30)(H,23,24,26) |
| InChIKey | HCDMCDKZEFKZHH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|