C20H29F3N6O4 — CID 135598581
N-hydroxy-N-[(2S)-2-[[[5-(piperidine-1-carbonyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide (PubChem CID 135598581) has the molecular formula C20H29F3N6O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is N-hydroxy-N-[(2S)-2-[[[5-(piperidine-1-carbonyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[(2S)-2-[[[5-(piperidine-1-carbonyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 135598581 |
| Molecular Formula | C20H29F3N6O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-hydroxy-N-[(2S)-2-[[[5-(piperidine-1-carbonyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCC[C@@H](CN(O)C=O)C(=O)NNc1ncc(C(=O)N2CCCCC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H29F3N6O4/c1-2-3-5-8-14(12-29(33)13-30)17(31)26-27-19-24-11-15(16(25-19)20(21,22)23)18(32)28-9-6-4-7-10-28/h11,13-14,33H,2-10,12H2,1H3,(H,26,31)(H,24,25,27)/t14-/m0/s1 |
| InChIKey | DSXJJSXQXPRAGA-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|