C15H20F3N5O5 — CID 10001430
2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylic acid (PubChem CID 10001430) has the molecular formula C15H20F3N5O5 and a molecular weight of 407.35 g/mol. Its IUPAC name is 2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 10001430 |
| Molecular Formula | C15H20F3N5O5 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1ncc(C(=O)O)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H20F3N5O5/c1-2-3-4-5-9(7-23(28)8-24)12(25)21-22-14-19-6-10(13(26)27)11(20-14)15(16,17)18/h6,8-9,28H,2-5,7H2,1H3,(H,21,25)(H,26,27)(H,19,20,22)/t9-/m1/s1 |
| InChIKey | RNGOYRMJHFBTRJ-SECBINFHSA-N |
| XLogP | 1.68 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|