C19H27F3N6O5 — CID 10254393
N-hydroxy-N-[(2R)-2-[[[5-(morpholine-4-carbonyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide (PubChem CID 10254393) has the molecular formula C19H27F3N6O5 and a molecular weight of 476.46 g/mol. Its IUPAC name is N-hydroxy-N-[(2R)-2-[[[5-(morpholine-4-carbonyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[(2R)-2-[[[5-(morpholine-4-carbonyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 10254393 |
| Molecular Formula | C19H27F3N6O5 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-hydroxy-N-[(2R)-2-[[[5-(morpholine-4-carbonyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1ncc(C(=O)N2CCOCC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H27F3N6O5/c1-2-3-4-5-13(11-28(32)12-29)16(30)25-26-18-23-10-14(15(24-18)19(20,21)22)17(31)27-6-8-33-9-7-27/h10,12-13,32H,2-9,11H2,1H3,(H,25,30)(H,23,24,26)/t13-/m1/s1 |
| InChIKey | AJQXMDPVSSEMTB-CYBMUJFWSA-N |
| XLogP | 1.46 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|