C18H28N4O4 — CID 154138667
pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate (PubChem CID 154138667) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate.
| Compound Name | pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 154138667 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate |
| SMILES | CCCCCOC(=O)c1cnc(N2CCOCC2)nc1N1CCOCC1 |
| InChI | InChI=1S/C18H28N4O4/c1-2-3-4-9-26-17(23)15-14-19-18(22-7-12-25-13-8-22)20-16(15)21-5-10-24-11-6-21/h14H,2-13H2,1H3 |
| InChIKey | WEKVFJIVPSULLD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|