pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate

C18H28N4O4 — CID 154138667

IUPACpentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate
SMILESCCCCCOC(=O)c1cnc(N2CCOCC2)nc1N1CCOCC1
InChIInChI=1S/C18H28N4O4/c1-2-3-4-9-26-17(23)15-14-19-18(22-7-12-25-13-8-22)20-16(15)21-5-10-24-11-6-21/h14H,2-13H2,1H3
InChIKeyWEKVFJIVPSULLD-UHFFFAOYSA-N
MW364.45 g/mol
LogP1.50
Rot. Bonds7

About pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate

pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate (PubChem CID 154138667) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate.

Molecular Properties

Compound Namepentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate
PubChem CID154138667
Molecular FormulaC18H28N4O4
Molecular Weight364.45 g/mol
Exact Mass364.21
IUPAC Namepentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate
SMILESCCCCCOC(=O)c1cnc(N2CCOCC2)nc1N1CCOCC1
InChIInChI=1S/C18H28N4O4/c1-2-3-4-9-26-17(23)15-14-19-18(22-7-12-25-13-8-22)20-16(15)21-5-10-24-11-6-21/h14H,2-13H2,1H3
InChIKeyWEKVFJIVPSULLD-UHFFFAOYSA-N
XLogP1.50
TPSA77.02 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds7
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500364.45
LogP ≤ 51.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate?
The IUPAC name of pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate (CID 154138667) is pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate.
What is the SMILES notation for pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate?
The canonical SMILES for pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate is CCCCCOC(=O)c1cnc(N2CCOCC2)nc1N1CCOCC1.
What is the InChIKey of pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate?
The InChIKey is WEKVFJIVPSULLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O4/c1-2-3-4-9-26-17(23)15-14-19-18(22-7-12-25-13-8-22)20-16(15)21-5-10-24-11-6-21/h14H,2-13H2,1H3.
What are the key properties of pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate?
pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate has a molecular weight of 364.45 g/mol, XLogP of 1.50, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate is sourced from PubChem (CID 154138667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).