C17H26N4O5 — CID 154109144
2-ethoxyethyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate (PubChem CID 154109144) has the molecular formula C17H26N4O5 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-ethoxyethyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate.
| Compound Name | 2-ethoxyethyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 154109144 |
| Molecular Formula | C17H26N4O5 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-ethoxyethyl 2,4-dimorpholin-4-ylpyrimidine-5-carboxylate |
| SMILES | CCOCCOC(=O)c1cnc(N2CCOCC2)nc1N1CCOCC1 |
| InChI | InChI=1S/C17H26N4O5/c1-2-23-11-12-26-16(22)14-13-18-17(21-5-9-25-10-6-21)19-15(14)20-3-7-24-8-4-20/h13H,2-12H2,1H3 |
| InChIKey | NUGMIVWUTBSCLJ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|