C13H18F2N4O2 — CID 102973247
ethyl 4-(difluoromethyl)-2-(4-methylpiperazin-1-yl)pyrimidine-5-carboxylate (PubChem CID 102973247) has the molecular formula C13H18F2N4O2 and a molecular weight of 300.31 g/mol. Its IUPAC name is ethyl 4-(difluoromethyl)-2-(4-methylpiperazin-1-yl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(difluoromethyl)-2-(4-methylpiperazin-1-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102973247 |
| Molecular Formula | C13H18F2N4O2 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl 4-(difluoromethyl)-2-(4-methylpiperazin-1-yl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(C)CC2)nc1C(F)F |
| InChI | InChI=1S/C13H18F2N4O2/c1-3-21-12(20)9-8-16-13(17-10(9)11(14)15)19-6-4-18(2)5-7-19/h8,11H,3-7H2,1-2H3 |
| InChIKey | WBFJCJLGUFQOAL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |