C9H11F2N3O2 — CID 138991320
ethyl 2-(aminomethyl)-4-(difluoromethyl)pyrimidine-5-carboxylate (PubChem CID 138991320) has the molecular formula C9H11F2N3O2 and a molecular weight of 231.20 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-4-(difluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(aminomethyl)-4-(difluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 138991320 |
| Molecular Formula | C9H11F2N3O2 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | ethyl 2-(aminomethyl)-4-(difluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CN)nc1C(F)F |
| InChI | InChI=1S/C9H11F2N3O2/c1-2-16-9(15)5-4-13-6(3-12)14-7(5)8(10)11/h4,8H,2-3,12H2,1H3 |
| InChIKey | JBBYWJAOPUANBA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |