C11H12ClF2N3O3 — CID 167799212
ethyl 2-[[(2-chloroacetyl)amino]methyl]-4-(difluoromethyl)pyrimidine-5-carboxylate (PubChem CID 167799212) has the molecular formula C11H12ClF2N3O3 and a molecular weight of 307.68 g/mol. Its IUPAC name is ethyl 2-[[(2-chloroacetyl)amino]methyl]-4-(difluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[(2-chloroacetyl)amino]methyl]-4-(difluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 167799212 |
| Molecular Formula | C11H12ClF2N3O3 |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | ethyl 2-[[(2-chloroacetyl)amino]methyl]-4-(difluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CNC(=O)CCl)nc1C(F)F |
| InChI | InChI=1S/C11H12ClF2N3O3/c1-2-20-11(19)6-4-15-7(5-16-8(18)3-12)17-9(6)10(13)14/h4,10H,2-3,5H2,1H3,(H,16,18) |
| InChIKey | FIPMUAXUUOVGND-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|