C11H11ClF3N3O3 — CID 166415202
ethyl 2-[[(2-chloroacetyl)amino]methyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 166415202) has the molecular formula C11H11ClF3N3O3 and a molecular weight of 325.67 g/mol. Its IUPAC name is ethyl 2-[[(2-chloroacetyl)amino]methyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[(2-chloroacetyl)amino]methyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 166415202 |
| Molecular Formula | C11H11ClF3N3O3 |
| Molecular Weight | 325.67 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | ethyl 2-[[(2-chloroacetyl)amino]methyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CNC(=O)CCl)nc1C(F)(F)F |
| InChI | InChI=1S/C11H11ClF3N3O3/c1-2-21-10(20)6-4-16-7(5-17-8(19)3-12)18-9(6)11(13,14)15/h4H,2-3,5H2,1H3,(H,17,19) |
| InChIKey | AGOJEYGHECMRND-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.67 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|