C18H20F3N3O2 — CID 2808715
ethyl 2-(4-butylanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 2808715) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is ethyl 2-(4-butylanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(4-butylanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2808715 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl 2-(4-butylanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCCCc1ccc(Nc2ncc(C(=O)OCC)c(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C18H20F3N3O2/c1-3-5-6-12-7-9-13(10-8-12)23-17-22-11-14(16(25)26-4-2)15(24-17)18(19,20)21/h7-11H,3-6H2,1-2H3,(H,22,23,24) |
| InChIKey | FCSYGUCOLIPONN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |