C20H15F3N4O2 — CID 142863982
[(2E)-2-ethenylpenta-2,4-dienyl] 2-(4-cyanoanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 142863982) has the molecular formula C20H15F3N4O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 2-(4-cyanoanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 2-(4-cyanoanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 142863982 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 2-(4-cyanoanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | C=C/C=C(\C=C)COC(=O)c1cnc(Nc2ccc(C#N)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C20H15F3N4O2/c1-3-5-13(4-2)12-29-18(28)16-11-25-19(27-17(16)20(21,22)23)26-15-8-6-14(10-24)7-9-15/h3-9,11H,1-2,12H2,(H,25,26,27)/b13-5+ |
| InChIKey | QECFLXIFHMVYDE-WLRTZDKTSA-N |
| XLogP | 4.57 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|