C19H12F3N5O — CID 109270050
N-(4-cyanophenyl)-2-[4-(trifluoromethyl)anilino]pyrimidine-5-carboxamide (PubChem CID 109270050) has the molecular formula C19H12F3N5O and a molecular weight of 383.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[4-(trifluoromethyl)anilino]pyrimidine-5-carboxamide.
| Compound Name | N-(4-cyanophenyl)-2-[4-(trifluoromethyl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109270050 |
| Molecular Formula | C19H12F3N5O |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-(4-cyanophenyl)-2-[4-(trifluoromethyl)anilino]pyrimidine-5-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cnc(Nc3ccc(C(F)(F)F)cc3)nc2)cc1 |
| InChI | InChI=1S/C19H12F3N5O/c20-19(21,22)14-3-7-16(8-4-14)27-18-24-10-13(11-25-18)17(28)26-15-5-1-12(9-23)2-6-15/h1-8,10-11H,(H,26,28)(H,24,25,27) |
| InChIKey | JWOACKYOEGRALZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |