C22H20N6O — CID 109270322
2-(4-cyanoanilino)-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-5-carboxamide (PubChem CID 109270322) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-cyanoanilino)-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109270322 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-(4-cyanoanilino)-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-5-carboxamide |
| SMILES | N#Cc1ccc(Nc2ncc(C(=O)Nc3ccc(N4CCCC4)cc3)cn2)cc1 |
| InChI | InChI=1S/C22H20N6O/c23-13-16-3-5-19(6-4-16)27-22-24-14-17(15-25-22)21(29)26-18-7-9-20(10-8-18)28-11-1-2-12-28/h3-10,14-15H,1-2,11-12H2,(H,26,29)(H,24,25,27) |
| InChIKey | ZIOUYHVNQOIGNF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|