C22H23N5O2 — CID 109269659
2-(4-methoxyanilino)-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-5-carboxamide (PubChem CID 109269659) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-methoxyanilino)-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109269659 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-(4-methoxyanilino)-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-5-carboxamide |
| SMILES | COc1ccc(Nc2ncc(C(=O)Nc3ccc(N4CCCC4)cc3)cn2)cc1 |
| InChI | InChI=1S/C22H23N5O2/c1-29-20-10-6-18(7-11-20)26-22-23-14-16(15-24-22)21(28)25-17-4-8-19(9-5-17)27-12-2-3-13-27/h4-11,14-15H,2-3,12-13H2,1H3,(H,25,28)(H,23,24,26) |
| InChIKey | XFEASWXUIPRJBR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|