C19H18F3N5O2 — CID 10092677
2-(3-cyanoanilino)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 10092677) has the molecular formula C19H18F3N5O2 and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(3-cyanoanilino)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10092677 |
| Molecular Formula | C19H18F3N5O2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-(3-cyanoanilino)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | N#Cc1cccc(Nc2ncc(C(=O)NCC3CCOCC3)c(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C19H18F3N5O2/c20-19(21,22)16-15(17(28)24-10-12-4-6-29-7-5-12)11-25-18(27-16)26-14-3-1-2-13(8-14)9-23/h1-3,8,11-12H,4-7,10H2,(H,24,28)(H,25,26,27) |
| InChIKey | UHZSWNHGVKSLGJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |