C22H26F3N3O3 — CID 58731842
N-(oxan-4-ylmethyl)-4-propan-2-yl-6-[3-(trifluoromethoxy)anilino]pyridine-3-carboxamide (PubChem CID 58731842) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is N-(oxan-4-ylmethyl)-4-propan-2-yl-6-[3-(trifluoromethoxy)anilino]pyridine-3-carboxamide.
| Compound Name | N-(oxan-4-ylmethyl)-4-propan-2-yl-6-[3-(trifluoromethoxy)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58731842 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-(oxan-4-ylmethyl)-4-propan-2-yl-6-[3-(trifluoromethoxy)anilino]pyridine-3-carboxamide |
| SMILES | CC(C)c1cc(Nc2cccc(OC(F)(F)F)c2)ncc1C(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C22H26F3N3O3/c1-14(2)18-11-20(28-16-4-3-5-17(10-16)31-22(23,24)25)26-13-19(18)21(29)27-12-15-6-8-30-9-7-15/h3-5,10-11,13-15H,6-9,12H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | LUOFVKBOUMXOBO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |