C22H29Cl2N3O2 — CID 142877799
6-[(3,7-dichlorocyclohepta-1,6-dien-1-yl)amino]-N-(oxan-4-ylmethyl)-4-propan-2-ylpyridine-3-carboxamide (PubChem CID 142877799) has the molecular formula C22H29Cl2N3O2 and a molecular weight of 438.40 g/mol. Its IUPAC name is 6-[(3,7-dichlorocyclohepta-1,6-dien-1-yl)amino]-N-(oxan-4-ylmethyl)-4-propan-2-ylpyridine-3-carboxamide.
| Compound Name | 6-[(3,7-dichlorocyclohepta-1,6-dien-1-yl)amino]-N-(oxan-4-ylmethyl)-4-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 142877799 |
| Molecular Formula | C22H29Cl2N3O2 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 6-[(3,7-dichlorocyclohepta-1,6-dien-1-yl)amino]-N-(oxan-4-ylmethyl)-4-propan-2-ylpyridine-3-carboxamide |
| SMILES | CC(C)c1cc(NC2=CC(Cl)CCC=C2Cl)ncc1C(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C22H29Cl2N3O2/c1-14(2)17-11-21(27-20-10-16(23)4-3-5-19(20)24)25-13-18(17)22(28)26-12-15-6-8-29-9-7-15/h5,10-11,13-16H,3-4,6-9,12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | FZYDWBCKTUGHLU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|