C19H18F3N5O2 — CID 68621550
[2-(4-cyanoanilino)-4-(trifluoromethyl)pyrimidin-5-yl] N-(cyclopentylmethyl)carbamate (PubChem CID 68621550) has the molecular formula C19H18F3N5O2 and a molecular weight of 405.38 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-4-(trifluoromethyl)pyrimidin-5-yl] N-(cyclopentylmethyl)carbamate.
| Compound Name | [2-(4-cyanoanilino)-4-(trifluoromethyl)pyrimidin-5-yl] N-(cyclopentylmethyl)carbamate |
|---|---|
| PubChem CID | 68621550 |
| Molecular Formula | C19H18F3N5O2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [2-(4-cyanoanilino)-4-(trifluoromethyl)pyrimidin-5-yl] N-(cyclopentylmethyl)carbamate |
| SMILES | N#Cc1ccc(Nc2ncc(OC(=O)NCC3CCCC3)c(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H18F3N5O2/c20-19(21,22)16-15(29-18(28)25-10-13-3-1-2-4-13)11-24-17(27-16)26-14-7-5-12(9-23)6-8-14/h5-8,11,13H,1-4,10H2,(H,25,28)(H,24,26,27) |
| InChIKey | ZXCKZPONYGXINH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |