C20H20F3N5O2 — CID 68620082
[2-(3-cyanoanilino)-4-(trifluoromethyl)pyrimidin-5-yl] N-(cyclohexylmethyl)carbamate (PubChem CID 68620082) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-4-(trifluoromethyl)pyrimidin-5-yl] N-(cyclohexylmethyl)carbamate.
| Compound Name | [2-(3-cyanoanilino)-4-(trifluoromethyl)pyrimidin-5-yl] N-(cyclohexylmethyl)carbamate |
|---|---|
| PubChem CID | 68620082 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [2-(3-cyanoanilino)-4-(trifluoromethyl)pyrimidin-5-yl] N-(cyclohexylmethyl)carbamate |
| SMILES | N#Cc1cccc(Nc2ncc(OC(=O)NCC3CCCCC3)c(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C20H20F3N5O2/c21-20(22,23)17-16(30-19(29)26-11-13-5-2-1-3-6-13)12-25-18(28-17)27-15-8-4-7-14(9-15)10-24/h4,7-9,12-13H,1-3,5-6,11H2,(H,26,29)(H,25,27,28) |
| InChIKey | RIMWSKLHNGKLSR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |