C15H11Cl2F3N4O3 — CID 2808694
ethyl 2-[2-(2,4-dichlorobenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 2808694) has the molecular formula C15H11Cl2F3N4O3 and a molecular weight of 423.18 g/mol. Its IUPAC name is ethyl 2-[2-(2,4-dichlorobenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[2-(2,4-dichlorobenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2808694 |
| Molecular Formula | C15H11Cl2F3N4O3 |
| Molecular Weight | 423.18 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | ethyl 2-[2-(2,4-dichlorobenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NNC(=O)c2ccc(Cl)cc2Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C15H11Cl2F3N4O3/c1-2-27-13(26)9-6-21-14(22-11(9)15(18,19)20)24-23-12(25)8-4-3-7(16)5-10(8)17/h3-6H,2H2,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | GLNPBEUISZGJHX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|