C20H18Cl2N6O3 — CID 19146373
ethyl 4-[[5-amino-6-[2-(2,4-dichlorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate (PubChem CID 19146373) has the molecular formula C20H18Cl2N6O3 and a molecular weight of 461.31 g/mol. Its IUPAC name is ethyl 4-[[5-amino-6-[2-(2,4-dichlorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-amino-6-[2-(2,4-dichlorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19146373 |
| Molecular Formula | C20H18Cl2N6O3 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | ethyl 4-[[5-amino-6-[2-(2,4-dichlorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccc(Cl)cc3Cl)c2N)cc1 |
| InChI | InChI=1S/C20H18Cl2N6O3/c1-2-31-20(30)11-3-6-13(7-4-11)26-17-16(23)18(25-10-24-17)27-28-19(29)14-8-5-12(21)9-15(14)22/h3-10H,2,23H2,1H3,(H,28,29)(H2,24,25,26,27) |
| InChIKey | SMORSCHHWWEHTB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|