C13H17F2N3O3 — CID 102973255
ethyl 4-(difluoromethyl)-2-(4-methylmorpholin-2-yl)pyrimidine-5-carboxylate (PubChem CID 102973255) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is ethyl 4-(difluoromethyl)-2-(4-methylmorpholin-2-yl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(difluoromethyl)-2-(4-methylmorpholin-2-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102973255 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | ethyl 4-(difluoromethyl)-2-(4-methylmorpholin-2-yl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C2CN(C)CCO2)nc1C(F)F |
| InChI | InChI=1S/C13H17F2N3O3/c1-3-20-13(19)8-6-16-12(17-10(8)11(14)15)9-7-18(2)4-5-21-9/h6,9,11H,3-5,7H2,1-2H3 |
| InChIKey | HYEBAASMGBEPAV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |