C12H15F2N3O3 — CID 79668892
4-(difluoromethyl)-2-(4-ethylmorpholin-2-yl)pyrimidine-5-carboxylic acid (PubChem CID 79668892) has the molecular formula C12H15F2N3O3 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-(4-ethylmorpholin-2-yl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-2-(4-ethylmorpholin-2-yl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 79668892 |
| Molecular Formula | C12H15F2N3O3 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-(difluoromethyl)-2-(4-ethylmorpholin-2-yl)pyrimidine-5-carboxylic acid |
| SMILES | CCN1CCOC(c2ncc(C(=O)O)c(C(F)F)n2)C1 |
| InChI | InChI=1S/C12H15F2N3O3/c1-2-17-3-4-20-8(6-17)11-15-5-7(12(18)19)9(16-11)10(13)14/h5,8,10H,2-4,6H2,1H3,(H,18,19) |
| InChIKey | AWDRGHRAHXNLKN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |