C15H16F2IN5O2S — CID 166341014
ethyl 4-(difluoromethyl)-2-[4-(5-iodopyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylate (PubChem CID 166341014) has the molecular formula C15H16F2IN5O2S and a molecular weight of 495.29 g/mol. Its IUPAC name is ethyl 4-(difluoromethyl)-2-[4-(5-iodopyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-(difluoromethyl)-2-[4-(5-iodopyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 166341014 |
| Molecular Formula | C15H16F2IN5O2S |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | ethyl 4-(difluoromethyl)-2-[4-(5-iodopyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2CCN(c3ncc(I)cn3)CC2)nc1C(F)F |
| InChI | InChI=1S/C15H16F2IN5O2S/c1-2-25-13(24)11-10(12(16)17)21-15(26-11)23-5-3-22(4-6-23)14-19-7-9(18)8-20-14/h7-8,12H,2-6H2,1H3 |
| InChIKey | OVJKZUKMKLNLGU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|