C15H18N4O2S — CID 70881073
ethyl 2-piperidin-1-yl-4-pyrazin-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 70881073) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is ethyl 2-piperidin-1-yl-4-pyrazin-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-piperidin-1-yl-4-pyrazin-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 70881073 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | ethyl 2-piperidin-1-yl-4-pyrazin-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2CCCCC2)nc1-c1cnccn1 |
| InChI | InChI=1S/C15H18N4O2S/c1-2-21-14(20)13-12(11-10-16-6-7-17-11)18-15(22-13)19-8-4-3-5-9-19/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | JWDGIIAOFPPQSS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |