C11H11N3O2S — CID 2740342
ethyl 4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 2740342) has the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. Its IUPAC name is ethyl 4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 2740342 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | ethyl 4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2cnccn2)nc1C |
| InChI | InChI=1S/C11H11N3O2S/c1-3-16-11(15)9-7(2)14-10(17-9)8-6-12-4-5-13-8/h4-6H,3H2,1-2H3 |
| InChIKey | MFKNHUMBYRXHLN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |