C13H20N4O2 — CID 142804810
ethyl 2-[4-(methylamino)piperidin-1-yl]pyrimidine-5-carboxylate (PubChem CID 142804810) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is ethyl 2-[4-(methylamino)piperidin-1-yl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[4-(methylamino)piperidin-1-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 142804810 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | ethyl 2-[4-(methylamino)piperidin-1-yl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCC(NC)CC2)nc1 |
| InChI | InChI=1S/C13H20N4O2/c1-3-19-12(18)10-8-15-13(16-9-10)17-6-4-11(14-2)5-7-17/h8-9,11,14H,3-7H2,1-2H3 |
| InChIKey | FSDVKBCMYGLNFR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |