C13H20N4O2 — CID 170606050
ethyl 2-(3,3-dimethylpiperazin-1-yl)pyrimidine-5-carboxylate (PubChem CID 170606050) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is ethyl 2-(3,3-dimethylpiperazin-1-yl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(3,3-dimethylpiperazin-1-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 170606050 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | ethyl 2-(3,3-dimethylpiperazin-1-yl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCNC(C)(C)C2)nc1 |
| InChI | InChI=1S/C13H20N4O2/c1-4-19-11(18)10-7-14-12(15-8-10)17-6-5-16-13(2,3)9-17/h7-8,16H,4-6,9H2,1-3H3 |
| InChIKey | GXTAUGJHOQZECN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |