C17H24N4O2 — CID 155678319
heptyl 4-(aziridin-1-yl)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (PubChem CID 155678319) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is heptyl 4-(aziridin-1-yl)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate.
| Compound Name | heptyl 4-(aziridin-1-yl)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
|---|---|
| PubChem CID | 155678319 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | heptyl 4-(aziridin-1-yl)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| SMILES | CCCCCCCOC(=O)c1cn2ncnc(N3CC3)c2c1C |
| InChI | InChI=1S/C17H24N4O2/c1-3-4-5-6-7-10-23-17(22)14-11-21-15(13(14)2)16(18-12-19-21)20-8-9-20/h11-12H,3-10H2,1-2H3 |
| InChIKey | HKMPINURGUDNAW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|