C14H21N3O4S — CID 153305749
butyl 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]acetate (PubChem CID 153305749) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is butyl 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]acetate.
| Compound Name | butyl 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]acetate |
|---|---|
| PubChem CID | 153305749 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | butyl 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]acetate |
| SMILES | CCCCOC(=O)Cc1cnc(N2CCS(=O)(=O)CC2)nc1 |
| InChI | InChI=1S/C14H21N3O4S/c1-2-3-6-21-13(18)9-12-10-15-14(16-11-12)17-4-7-22(19,20)8-5-17/h10-11H,2-9H2,1H3 |
| InChIKey | CEOFIJNWGNGROT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|