C15H24N4O4S — CID 135263313
tert-butyl 2-[2-(4-methylsulfonylpiperazin-1-yl)pyrimidin-5-yl]acetate (PubChem CID 135263313) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is tert-butyl 2-[2-(4-methylsulfonylpiperazin-1-yl)pyrimidin-5-yl]acetate.
| Compound Name | tert-butyl 2-[2-(4-methylsulfonylpiperazin-1-yl)pyrimidin-5-yl]acetate |
|---|---|
| PubChem CID | 135263313 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | tert-butyl 2-[2-(4-methylsulfonylpiperazin-1-yl)pyrimidin-5-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1cnc(N2CCN(S(C)(=O)=O)CC2)nc1 |
| InChI | InChI=1S/C15H24N4O4S/c1-15(2,3)23-13(20)9-12-10-16-14(17-11-12)18-5-7-19(8-6-18)24(4,21)22/h10-11H,5-9H2,1-4H3 |
| InChIKey | HWIDDDOUWVSRLJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |