C15H24N4O2 — CID 115580851
tert-butyl 3-(4-pyrimidin-2-ylpiperazin-1-yl)propanoate (PubChem CID 115580851) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl 3-(4-pyrimidin-2-ylpiperazin-1-yl)propanoate.
| Compound Name | tert-butyl 3-(4-pyrimidin-2-ylpiperazin-1-yl)propanoate |
|---|---|
| PubChem CID | 115580851 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | tert-butyl 3-(4-pyrimidin-2-ylpiperazin-1-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)CCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C15H24N4O2/c1-15(2,3)21-13(20)5-8-18-9-11-19(12-10-18)14-16-6-4-7-17-14/h4,6-7H,5,8-12H2,1-3H3 |
| InChIKey | YTTGTBSRFJBJTJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |