C20H30N4O4 — CID 175834130
butyl 7-[5-(2-ethoxy-2-oxoethyl)pyrimidin-2-yl]-2,7-diazaspiro[3.5]nonane-2-carboxylate (PubChem CID 175834130) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is butyl 7-[5-(2-ethoxy-2-oxoethyl)pyrimidin-2-yl]-2,7-diazaspiro[3.5]nonane-2-carboxylate.
| Compound Name | butyl 7-[5-(2-ethoxy-2-oxoethyl)pyrimidin-2-yl]-2,7-diazaspiro[3.5]nonane-2-carboxylate |
|---|---|
| PubChem CID | 175834130 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | butyl 7-[5-(2-ethoxy-2-oxoethyl)pyrimidin-2-yl]-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| SMILES | CCCCOC(=O)N1CC2(CCN(c3ncc(CC(=O)OCC)cn3)CC2)C1 |
| InChI | InChI=1S/C20H30N4O4/c1-3-5-10-28-19(26)24-14-20(15-24)6-8-23(9-7-20)18-21-12-16(13-22-18)11-17(25)27-4-2/h12-13H,3-11,14-15H2,1-2H3 |
| InChIKey | COIOMQTVDRVBTN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|